C10H15N — CID 134458823
(1S,3R,6R)-N,N-dimethylbicyclo[4.2.0]oct-7-yn-3-amine (PubChem CID 134458823) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is (1S,3R,6R)-N,N-dimethylbicyclo[4.2.0]oct-7-yn-3-amine.
| Compound Name | (1S,3R,6R)-N,N-dimethylbicyclo[4.2.0]oct-7-yn-3-amine |
|---|---|
| PubChem CID | 134458823 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | (1S,3R,6R)-N,N-dimethylbicyclo[4.2.0]oct-7-yn-3-amine |
| SMILES | CN(C)[C@@H]1CC[C@H]2C#C[C@H]2C1 |
| InChI | InChI=1S/C10H15N/c1-11(2)10-6-5-8-3-4-9(8)7-10/h8-10H,5-7H2,1-2H3/t8-,9+,10-/m1/s1 |
| InChIKey | MTLSGZPALPMXKE-KXUCPTDWSA-N |
| XLogP | 1.35 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|