C14H17N5O3 — CID 134458854
N-[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-imino-2-(methylideneamino)acetamide (PubChem CID 134458854) has the molecular formula C14H17N5O3 and a molecular weight of 303.32 g/mol. Its IUPAC name is N-[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-imino-2-(methylideneamino)acetamide.
| Compound Name | N-[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-imino-2-(methylideneamino)acetamide |
|---|---|
| PubChem CID | 134458854 |
| Molecular Formula | C14H17N5O3 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[(3S)-1,7-dimethyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-imino-2-(methylideneamino)acetamide |
| SMILES | [H]/N=C(\N=C)C(=O)N[C@H]1CCc2cn(C)c(=O)cc2N(C)C1=O |
| InChI | InChI=1S/C14H17N5O3/c1-16-12(15)13(21)17-9-5-4-8-7-18(2)11(20)6-10(8)19(3)14(9)22/h6-7,9,15H,1,4-5H2,2-3H3,(H,17,21)/b15-12-/t9-/m0/s1 |
| InChIKey | QWOYKWRLIWQACN-YHMWOKNVSA-N |
| XLogP | -0.54 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|