C24H28FN5O3 — CID 134458873
N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-[4-(2-fluorophenyl)butylideneamino]-2-iminoacetamide (PubChem CID 134458873) has the molecular formula C24H28FN5O3 and a molecular weight of 453.52 g/mol. Its IUPAC name is N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-[4-(2-fluorophenyl)butylideneamino]-2-iminoacetamide.
| Compound Name | N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-[4-(2-fluorophenyl)butylideneamino]-2-iminoacetamide |
|---|---|
| PubChem CID | 134458873 |
| Molecular Formula | C24H28FN5O3 |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[(3R)-7-ethyl-1-methyl-2,8-dioxo-4,5-dihydro-3H-pyrido[4,3-b]azepin-3-yl]-2-[4-(2-fluorophenyl)butylideneamino]-2-iminoacetamide |
| SMILES | [H]/N=C(\N=C\CCCc1ccccc1F)C(=O)N[C@@H]1CCc2cn(CC)c(=O)cc2N(C)C1=O |
| InChI | InChI=1S/C24H28FN5O3/c1-3-30-15-17-11-12-19(24(33)29(2)20(17)14-21(30)31)28-23(32)22(26)27-13-7-6-9-16-8-4-5-10-18(16)25/h4-5,8,10,13-15,19,26H,3,6-7,9,11-12H2,1-2H3,(H,28,32)/b26-22-,27-13+/t19-/m1/s1 |
| InChIKey | ZXXLKKUHNMDUKA-RHQFBZKSSA-N |
| XLogP | 2.47 |
| TPSA | 107.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|