About cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine
cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine (PubChem CID 134459091) has the molecular formula C16H23FN2
and a molecular weight of 262.37 g/mol. Its IUPAC name is cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine |
| PubChem CID | 134459091 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine |
| SMILES | CN=CC1C[C@@H](CC[C@@H]1N(C)C)C2=CC=CC=C2F |
| InChI | InChI=1S/C16H23FN2/c1-18-11-13-10-12(8-9-16(13)19(2)3)14-6-4-5-7-15(14)17/h4-7,11-13,16H,8-10H2,1-3H3/t12-,13?,16+/m1/s1 |
| InChIKey | RJGBYRZAROMIKZ-LRRQEPCHSA-N |
| XLogP | 2.70 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | 303 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The IUPAC name of cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine (CID 134459091) is cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine.
What is the SMILES notation for cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The canonical SMILES for cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine is CN=CC1C[C@@H](CC[C@@H]1N(C)C)C2=CC=CC=C2F.
What is the InChIKey of cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The InChIKey is RJGBYRZAROMIKZ-LRRQEPCHSA-N. The full InChI is InChI=1S/C16H23FN2/c1-18-11-13-10-12(8-9-16(13)19(2)3)14-6-4-5-7-15(14)17/h4-7,11-13,16H,8-10H2,1-3H3/t12-,13?,16+/m1/s1.
What are the key properties of cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine has a molecular weight of 262.37 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1S,4R)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine is sourced from PubChem (CID 134459091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).