About trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine
trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine (PubChem CID 134459102) has the molecular formula C16H23FN2
and a molecular weight of 262.37 g/mol. Its IUPAC name is trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine.
Molecular Properties
| Compound Name | trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine |
| PubChem CID | 134459102 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine |
| SMILES | C/N=C/C1C[C@@H](c2ccccc2F)CC[C@@H]1N(C)C |
| InChI | InChI=1S/C16H23FN2/c1-18-11-13-10-12(8-9-16(13)19(2)3)14-6-4-5-7-15(14)17/h4-7,11-13,16H,8-10H2,1-3H3/b18-11+/t12-,13?,16-/m0/s1 |
| InChIKey | RJGBYRZAROMIKZ-AOHUTSPNSA-N |
| XLogP | 3.34 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The IUPAC name of trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine (CID 134459102) is trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine.
What is the SMILES notation for trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The canonical SMILES for trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine is C/N=C/C1C[C@@H](c2ccccc2F)CC[C@@H]1N(C)C.
What is the InChIKey of trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
The InChIKey is RJGBYRZAROMIKZ-AOHUTSPNSA-N. The full InChI is InChI=1S/C16H23FN2/c1-18-11-13-10-12(8-9-16(13)19(2)3)14-6-4-5-7-15(14)17/h4-7,11-13,16H,8-10H2,1-3H3/b18-11+/t12-,13?,16-/m0/s1.
What are the key properties of trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine?
trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine has a molecular weight of 262.37 g/mol, XLogP of 3.34, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,4S)-4-(2-fluorophenyl)-N,N-dimethyl-2-(methyliminomethyl)cyclohexan-1-amine is sourced from PubChem (CID 134459102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).