C17H23F3N2 — CID 134459195
cis-(1S,5R)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine (PubChem CID 134459195) has the molecular formula C17H23F3N2 and a molecular weight of 312.38 g/mol. Its IUPAC name is cis-(1S,5R)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine.
| Compound Name | cis-(1S,5R)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 134459195 |
| Molecular Formula | C17H23F3N2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | cis-(1S,5R)-N,N-dimethyl-2-(methyliminomethyl)-5-[3-(trifluoromethyl)phenyl]cyclohexan-1-amine |
| SMILES | C/N=C/C1CC[C@@H](c2cccc(C(F)(F)F)c2)C[C@@H]1N(C)C |
| InChI | InChI=1S/C17H23F3N2/c1-21-11-14-8-7-13(10-16(14)22(2)3)12-5-4-6-15(9-12)17(18,19)20/h4-6,9,11,13-14,16H,7-8,10H2,1-3H3/b21-11+/t13-,14?,16+/m1/s1 |
| InChIKey | AYISLHQLRNOULH-GUHRPXKNSA-N |
| XLogP | 4.22 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|