C10H8ClFN2O2S2 — CID 134459368
5-chloro-2-fluoro-4-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide (PubChem CID 134459368) has the molecular formula C10H8ClFN2O2S2 and a molecular weight of 306.77 g/mol. Its IUPAC name is 5-chloro-2-fluoro-4-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide.
| Compound Name | 5-chloro-2-fluoro-4-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 134459368 |
| Molecular Formula | C10H8ClFN2O2S2 |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 305.97 |
| IUPAC Name | 5-chloro-2-fluoro-4-methyl-N-(1,3-thiazol-2-yl)benzenesulfonamide |
| SMILES | Cc1cc(F)c(S(=O)(=O)Nc2nccs2)cc1Cl |
| InChI | InChI=1S/C10H8ClFN2O2S2/c1-6-4-8(12)9(5-7(6)11)18(15,16)14-10-13-2-3-17-10/h2-5H,1H3,(H,13,14) |
| InChIKey | KZTGHNRNNJWUAT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |