About (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine
(1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine (PubChem CID 134459387) has the molecular formula C11H17F3N2
and a molecular weight of 234.26 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine.
Molecular Properties
| Compound Name | (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine |
| PubChem CID | 134459387 |
| Molecular Formula | C11H17F3N2 |
| Molecular Weight | 234.26 g/mol |
| Exact Mass | 234.13 |
| IUPAC Name | (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine |
| SMILES | C/N=C/C1CC=C(C(F)(F)F)C[C@@H]1N(C)C |
| InChI | InChI=1S/C11H17F3N2/c1-15-7-8-4-5-9(11(12,13)14)6-10(8)16(2)3/h5,7-8,10H,4,6H2,1-3H3/b15-7+/t8?,10-/m0/s1 |
| InChIKey | UGOIDAOGUJRDJR-IDCOZLHQSA-N |
| XLogP | 2.52 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.26 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine?
The IUPAC name of (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine (CID 134459387) is (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine.
What is the SMILES notation for (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine?
The canonical SMILES for (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine is C/N=C/C1CC=C(C(F)(F)F)C[C@@H]1N(C)C.
What is the InChIKey of (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine?
The InChIKey is UGOIDAOGUJRDJR-IDCOZLHQSA-N. The full InChI is InChI=1S/C11H17F3N2/c1-15-7-8-4-5-9(11(12,13)14)6-10(8)16(2)3/h5,7-8,10H,4,6H2,1-3H3/b15-7+/t8?,10-/m0/s1.
What are the key properties of (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine?
(1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine has a molecular weight of 234.26 g/mol, XLogP of 2.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N,N-dimethyl-6-(methyliminomethyl)-3-(trifluoromethyl)cyclohex-3-en-1-amine is sourced from PubChem (CID 134459387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).