C21H24N4O5 — CID 134459694
N-hydroxy-1'-[[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide (PubChem CID 134459694) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is N-hydroxy-1'-[[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide.
| Compound Name | N-hydroxy-1'-[[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide |
|---|---|
| PubChem CID | 134459694 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | N-hydroxy-1'-[[5-(oxan-4-yl)-1,2,4-oxadiazol-3-yl]methyl]-2'-oxospiro[1,3-dihydroindene-2,3'-pyrrolidine]-4-carboxamide |
| SMILES | O=C(NO)c1cccc2c1CC1(CCN(Cc3noc(C4CCOCC4)n3)C1=O)C2 |
| InChI | InChI=1S/C21H24N4O5/c26-18(23-28)15-3-1-2-14-10-21(11-16(14)15)6-7-25(20(21)27)12-17-22-19(30-24-17)13-4-8-29-9-5-13/h1-3,13,28H,4-12H2,(H,23,26) |
| InChIKey | BOWADQUJRAFLNB-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 117.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|