C21H28N2O5 — CID 134459911
N-hydroxy-1'-(4-methyloxane-4-carbonyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-8-carboxamide (PubChem CID 134459911) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is N-hydroxy-1'-(4-methyloxane-4-carbonyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-8-carboxamide.
| Compound Name | N-hydroxy-1'-(4-methyloxane-4-carbonyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-8-carboxamide |
|---|---|
| PubChem CID | 134459911 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | N-hydroxy-1'-(4-methyloxane-4-carbonyl)spiro[3,4-dihydrochromene-2,4'-piperidine]-8-carboxamide |
| SMILES | CC1(C(=O)N2CCC3(CCc4cccc(C(=O)NO)c4O3)CC2)CCOCC1 |
| InChI | InChI=1S/C21H28N2O5/c1-20(9-13-27-14-10-20)19(25)23-11-7-21(8-12-23)6-5-15-3-2-4-16(17(15)28-21)18(24)22-26/h2-4,26H,5-14H2,1H3,(H,22,24) |
| InChIKey | MACFALOLYMNNOP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|