About 5-chloro-1,2-dihydropyridin-6-amine
5-chloro-1,2-dihydropyridin-6-amine (PubChem CID 134460154) has the molecular formula C5H7ClN2
and a molecular weight of 130.58 g/mol. Its IUPAC name is 5-chloro-1,2-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 5-chloro-1,2-dihydropyridin-6-amine |
| PubChem CID | 134460154 |
| Molecular Formula | C5H7ClN2 |
| Molecular Weight | 130.58 g/mol |
| Exact Mass | 130.03 |
| IUPAC Name | 5-chloro-1,2-dihydropyridin-6-amine |
| SMILES | NC1=C(Cl)C=CCN1 |
| InChI | InChI=1S/C5H7ClN2/c6-4-2-1-3-8-5(4)7/h1-2,8H,3,7H2 |
| InChIKey | VOJIMCMXSCLFRV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.58 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-chloro-1,2-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2-dihydropyridin-6-amine?
The IUPAC name of 5-chloro-1,2-dihydropyridin-6-amine (CID 134460154) is 5-chloro-1,2-dihydropyridin-6-amine.
What is the SMILES notation for 5-chloro-1,2-dihydropyridin-6-amine?
The canonical SMILES for 5-chloro-1,2-dihydropyridin-6-amine is NC1=C(Cl)C=CCN1.
What is the InChIKey of 5-chloro-1,2-dihydropyridin-6-amine?
The InChIKey is VOJIMCMXSCLFRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2/c6-4-2-1-3-8-5(4)7/h1-2,8H,3,7H2.
What are the key properties of 5-chloro-1,2-dihydropyridin-6-amine?
5-chloro-1,2-dihydropyridin-6-amine has a molecular weight of 130.58 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2-dihydropyridin-6-amine is sourced from PubChem (CID 134460154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).