C26H26F3N7O4 — CID 134460178
2-(6-aminopurin-9-yl)-5-[[2-[5-methoxy-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol (PubChem CID 134460178) has the molecular formula C26H26F3N7O4 and a molecular weight of 557.53 g/mol. Its IUPAC name is 2-(6-aminopurin-9-yl)-5-[[2-[5-methoxy-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | 2-(6-aminopurin-9-yl)-5-[[2-[5-methoxy-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 134460178 |
| Molecular Formula | C26H26F3N7O4 |
| Molecular Weight | 557.53 g/mol |
| Exact Mass | 557.20 |
| IUPAC Name | 2-(6-aminopurin-9-yl)-5-[[2-[5-methoxy-2-(trifluoromethyl)carbazol-9-yl]ethylamino]methyl]oxolane-3,4-diol |
| SMILES | COc1cccc2c1c1ccc(C(F)(F)F)cc1n2CCNCC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
| InChI | InChI=1S/C26H26F3N7O4/c1-39-17-4-2-3-15-19(17)14-6-5-13(26(27,28)29)9-16(14)35(15)8-7-31-10-18-21(37)22(38)25(40-18)36-12-34-20-23(30)32-11-33-24(20)36/h2-6,9,11-12,18,21-22,25,31,37-38H,7-8,10H2,1H3,(H2,30,32,33) |
| InChIKey | KTHQSRZOLPZSNC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 145.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.53 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|