C22H15Cl3N8S3 — CID 134460888
4-[[5-(3-chloro-5-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-6-[[5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-methylsulfanylpyrimidine (PubChem CID 134460888) has the molecular formula C22H15Cl3N8S3 and a molecular weight of 593.98 g/mol. Its IUPAC name is 4-[[5-(3-chloro-5-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-6-[[5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-methylsulfanylpyrimidine.
| Compound Name | 4-[[5-(3-chloro-5-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-6-[[5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-methylsulfanylpyrimidine |
|---|---|
| PubChem CID | 134460888 |
| Molecular Formula | C22H15Cl3N8S3 |
| Molecular Weight | 593.98 g/mol |
| Exact Mass | 591.96 |
| IUPAC Name | 4-[[5-(3-chloro-5-methylphenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-6-[[5-(3,5-dichlorophenyl)-1H-1,2,4-triazol-3-yl]sulfanyl]-2-methylsulfanylpyrimidine |
| SMILES | CSc1nc(Sc2n[nH]c(-c3cc(C)cc(Cl)c3)n2)cc(Sc2n[nH]c(-c3cc(Cl)cc(Cl)c3)n2)n1 |
| InChI | InChI=1S/C22H15Cl3N8S3/c1-10-3-11(5-13(23)4-10)18-28-21(32-30-18)35-16-9-17(27-20(26-16)34-2)36-22-29-19(31-33-22)12-6-14(24)8-15(25)7-12/h3-9H,1-2H3,(H,28,30,32)(H,29,31,33) |
| InChIKey | BZMLBODGMVNNOU-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.98 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |