About (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate
(1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate (PubChem CID 134460944) has the molecular formula C19H34O4
and a molecular weight of 326.48 g/mol. Its IUPAC name is (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate.
Molecular Properties
| Compound Name | (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate |
| PubChem CID | 134460944 |
| Molecular Formula | C19H34O4 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.25 |
| IUPAC Name | (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate |
| SMILES | CCC(C)(CC(C)C)C(=O)OC1(C)CC2(O)CCCC(O)(C2)C1 |
| InChI | InChI=1S/C19H34O4/c1-6-16(4,10-14(2)3)15(20)23-17(5)11-18(21)8-7-9-19(22,12-17)13-18/h14,21-22H,6-13H2,1-5H3 |
| InChIKey | ULXSUVACBPOHAD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate?
The IUPAC name of (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate (CID 134460944) is (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate.
What is the SMILES notation for (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate?
The canonical SMILES for (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate is CCC(C)(CC(C)C)C(=O)OC1(C)CC2(O)CCCC(O)(C2)C1.
What is the InChIKey of (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate?
The InChIKey is ULXSUVACBPOHAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O4/c1-6-16(4,10-14(2)3)15(20)23-17(5)11-18(21)8-7-9-19(22,12-17)13-18/h14,21-22H,6-13H2,1-5H3.
What are the key properties of (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate?
(1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate has a molecular weight of 326.48 g/mol, XLogP of 3.58, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dihydroxy-3-methyl-3-bicyclo[3.3.1]nonanyl) 2-ethyl-2,4-dimethylpentanoate is sourced from PubChem (CID 134460944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).