C17H24N2O3 — CID 134460952
(2E,4E,6R)-7-[4-(dimethylamino)cyclohexa-1,5-dien-1-yl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide (PubChem CID 134460952) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is (2E,4E,6R)-7-[4-(dimethylamino)cyclohexa-1,5-dien-1-yl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide.
| Compound Name | (2E,4E,6R)-7-[4-(dimethylamino)cyclohexa-1,5-dien-1-yl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
|---|---|
| PubChem CID | 134460952 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | (2E,4E,6R)-7-[4-(dimethylamino)cyclohexa-1,5-dien-1-yl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NO)=C\[C@@H](C)C(=O)C1=CCC(N(C)C)C=C1 |
| InChI | InChI=1S/C17H24N2O3/c1-12(5-10-16(20)18-22)11-13(2)17(21)14-6-8-15(9-7-14)19(3)4/h5-8,10-11,13,15,22H,9H2,1-4H3,(H,18,20)/b10-5+,12-11+/t13-,15?/m1/s1 |
| InChIKey | RIUCUKIJYRMVCB-WKCHHASASA-N |
| XLogP | 2.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|