About (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate
(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate (PubChem CID 134461148) has the molecular formula C16H11N3O2
and a molecular weight of 277.28 g/mol. Its IUPAC name is (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate.
Molecular Properties
| Compound Name | (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate |
| PubChem CID | 134461148 |
| Molecular Formula | C16H11N3O2 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate |
| SMILES | N#COC1N=C(c2ccccc2)c2ccccc2NC1=O |
| InChI | InChI=1S/C16H11N3O2/c17-10-21-16-15(20)18-13-9-5-4-8-12(13)14(19-16)11-6-2-1-3-7-11/h1-9,16H,(H,18,20) |
| InChIKey | YMFMNKCROZWGBY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate?
The IUPAC name of (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate (CID 134461148) is (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate.
What is the SMILES notation for (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate?
The canonical SMILES for (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate is N#COC1N=C(c2ccccc2)c2ccccc2NC1=O.
What is the InChIKey of (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate?
The InChIKey is YMFMNKCROZWGBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N3O2/c17-10-21-16-15(20)18-13-9-5-4-8-12(13)14(19-16)11-6-2-1-3-7-11/h1-9,16H,(H,18,20).
What are the key properties of (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate?
(2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate has a molecular weight of 277.28 g/mol, XLogP of 2.30, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-5-phenyl-1,3-dihydro-1,4-benzodiazepin-3-yl) cyanate is sourced from PubChem (CID 134461148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).