C12H16N2O4S — CID 134461219
ethyl 2-acetyl-5-morpholin-4-yl-1,3-thiazole-4-carboxylate (PubChem CID 134461219) has the molecular formula C12H16N2O4S and a molecular weight of 284.34 g/mol. Its IUPAC name is ethyl 2-acetyl-5-morpholin-4-yl-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-acetyl-5-morpholin-4-yl-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 134461219 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 2-acetyl-5-morpholin-4-yl-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(C(C)=O)sc1N1CCOCC1 |
| InChI | InChI=1S/C12H16N2O4S/c1-3-18-12(16)9-11(14-4-6-17-7-5-14)19-10(13-9)8(2)15/h3-7H2,1-2H3 |
| InChIKey | CDXAWPATJGWYME-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 68.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |