About 6-butan-2-yl-N,N-dimethylpyridin-3-amine
6-butan-2-yl-N,N-dimethylpyridin-3-amine (PubChem CID 134461277) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 6-butan-2-yl-N,N-dimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 6-butan-2-yl-N,N-dimethylpyridin-3-amine |
| PubChem CID | 134461277 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 6-butan-2-yl-N,N-dimethylpyridin-3-amine |
| SMILES | CCC(C)c1ccc(N(C)C)cn1 |
| InChI | InChI=1S/C11H18N2/c1-5-9(2)11-7-6-10(8-12-11)13(3)4/h6-9H,5H2,1-4H3 |
| InChIKey | RVGAFZSDSSRNSW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-butan-2-yl-N,N-dimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butan-2-yl-N,N-dimethylpyridin-3-amine?
The IUPAC name of 6-butan-2-yl-N,N-dimethylpyridin-3-amine (CID 134461277) is 6-butan-2-yl-N,N-dimethylpyridin-3-amine.
What is the SMILES notation for 6-butan-2-yl-N,N-dimethylpyridin-3-amine?
The canonical SMILES for 6-butan-2-yl-N,N-dimethylpyridin-3-amine is CCC(C)c1ccc(N(C)C)cn1.
What is the InChIKey of 6-butan-2-yl-N,N-dimethylpyridin-3-amine?
The InChIKey is RVGAFZSDSSRNSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-5-9(2)11-7-6-10(8-12-11)13(3)4/h6-9H,5H2,1-4H3.
What are the key properties of 6-butan-2-yl-N,N-dimethylpyridin-3-amine?
6-butan-2-yl-N,N-dimethylpyridin-3-amine has a molecular weight of 178.28 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butan-2-yl-N,N-dimethylpyridin-3-amine is sourced from PubChem (CID 134461277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).