C26H20F5N7O3S — CID 134461518
(3S)-3-[[5-[5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 134461518) has the molecular formula C26H20F5N7O3S and a molecular weight of 605.55 g/mol. Its IUPAC name is (3S)-3-[[5-[5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[[5-[5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 134461518 |
| Molecular Formula | C26H20F5N7O3S |
| Molecular Weight | 605.55 g/mol |
| Exact Mass | 605.13 |
| IUPAC Name | (3S)-3-[[5-[5-morpholin-4-yl-2-(1,1,2,2,2-pentafluoroethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccccc2C(c2ccccc2)=N[C@@H]1Nc1nnc(-c2nc(C(F)(F)C(F)(F)F)sc2N2CCOCC2)o1 |
| InChI | InChI=1S/C26H20F5N7O3S/c27-25(28,26(29,30)31)23-34-18(22(42-23)38-10-12-40-13-11-38)21-36-37-24(41-21)35-19-20(39)32-16-9-5-4-8-15(16)17(33-19)14-6-2-1-3-7-14/h1-9,19H,10-13H2,(H,32,39)(H,35,37)/t19-/m1/s1 |
| InChIKey | BJXKQRLXUBTSCU-LJQANCHMSA-N |
| XLogP | 4.91 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.55 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|