C24H20F3N7O3S — CID 134461657
(3S)-3-[[5-[5-(2-methoxyethylamino)-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 134461657) has the molecular formula C24H20F3N7O3S and a molecular weight of 543.53 g/mol. Its IUPAC name is (3S)-3-[[5-[5-(2-methoxyethylamino)-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[[5-[5-(2-methoxyethylamino)-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 134461657 |
| Molecular Formula | C24H20F3N7O3S |
| Molecular Weight | 543.53 g/mol |
| Exact Mass | 543.13 |
| IUPAC Name | (3S)-3-[[5-[5-(2-methoxyethylamino)-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | COCCNc1sc(C(F)(F)F)nc1-c1nnc(N[C@H]2N=C(c3ccccc3)c3ccccc3NC2=O)o1 |
| InChI | InChI=1S/C24H20F3N7O3S/c1-36-12-11-28-21-17(31-22(38-21)24(25,26)27)20-33-34-23(37-20)32-18-19(35)29-15-10-6-5-9-14(15)16(30-18)13-7-3-2-4-8-13/h2-10,18,28H,11-12H2,1H3,(H,29,35)(H,32,34)/t18-/m1/s1 |
| InChIKey | IZSVWUMEXMVQMM-GOSISDBHSA-N |
| XLogP | 4.50 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.53 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|