C25H19F3N8O3S — CID 134461699
(3S)-3-[[5-[5-[[(3R)-2-oxopyrrolidin-3-yl]amino]-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one (PubChem CID 134461699) has the molecular formula C25H19F3N8O3S and a molecular weight of 568.54 g/mol. Its IUPAC name is (3S)-3-[[5-[5-[[(3R)-2-oxopyrrolidin-3-yl]amino]-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one.
| Compound Name | (3S)-3-[[5-[5-[[(3R)-2-oxopyrrolidin-3-yl]amino]-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
|---|---|
| PubChem CID | 134461699 |
| Molecular Formula | C25H19F3N8O3S |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 568.13 |
| IUPAC Name | (3S)-3-[[5-[5-[[(3R)-2-oxopyrrolidin-3-yl]amino]-2-(trifluoromethyl)-1,3-thiazol-4-yl]-1,3,4-oxadiazol-2-yl]amino]-5-phenyl-1,3-dihydro-1,4-benzodiazepin-2-one |
| SMILES | O=C1Nc2ccccc2C(c2ccccc2)=N[C@@H]1Nc1nnc(-c2nc(C(F)(F)F)sc2N[C@@H]2CCNC2=O)o1 |
| InChI | InChI=1S/C25H19F3N8O3S/c26-25(27,28)23-33-17(22(40-23)31-15-10-11-29-19(15)37)21-35-36-24(39-21)34-18-20(38)30-14-9-5-4-8-13(14)16(32-18)12-6-2-1-3-7-12/h1-9,15,18,31H,10-11H2,(H,29,37)(H,30,38)(H,34,36)/t15-,18-/m1/s1 |
| InChIKey | BDZPVGRHNSGESN-CRAIPNDOSA-N |
| XLogP | 3.74 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |