About ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate
ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate (PubChem CID 134461736) has the molecular formula C12H16F3N3O3
and a molecular weight of 307.27 g/mol. Its IUPAC name is ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate |
| PubChem CID | 134461736 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cn(CC(F)(F)F)nc1N1CCOCC1 |
| InChI | InChI=1S/C12H16F3N3O3/c1-2-21-11(19)9-7-18(8-12(13,14)15)16-10(9)17-3-5-20-6-4-17/h7H,2-6,8H2,1H3 |
| InChIKey | WXWMTDMXYLXBBO-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate?
The IUPAC name of ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate (CID 134461736) is ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate.
What is the SMILES notation for ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate?
The canonical SMILES for ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate is CCOC(=O)c1cn(CC(F)(F)F)nc1N1CCOCC1.
What is the InChIKey of ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate?
The InChIKey is WXWMTDMXYLXBBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16F3N3O3/c1-2-21-11(19)9-7-18(8-12(13,14)15)16-10(9)17-3-5-20-6-4-17/h7H,2-6,8H2,1H3.
What are the key properties of ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate?
ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate has a molecular weight of 307.27 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-morpholin-4-yl-1-(2,2,2-trifluoroethyl)pyrazole-4-carboxylate is sourced from PubChem (CID 134461736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).