About (4-amino-3,5-difluorophenyl)methoxymethanol
(4-amino-3,5-difluorophenyl)methoxymethanol (PubChem CID 134461789) has the molecular formula C8H9F2NO2
and a molecular weight of 189.16 g/mol. Its IUPAC name is (4-amino-3,5-difluorophenyl)methoxymethanol.
Molecular Properties
| Compound Name | (4-amino-3,5-difluorophenyl)methoxymethanol |
| PubChem CID | 134461789 |
| Molecular Formula | C8H9F2NO2 |
| Molecular Weight | 189.16 g/mol |
| Exact Mass | 189.06 |
| IUPAC Name | (4-amino-3,5-difluorophenyl)methoxymethanol |
| SMILES | Nc1c(F)cc(COCO)cc1F |
| InChI | InChI=1S/C8H9F2NO2/c9-6-1-5(3-13-4-12)2-7(10)8(6)11/h1-2,12H,3-4,11H2 |
| InChIKey | BKEZVAAAYYSUMY-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.16 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-3,5-difluorophenyl)methoxymethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-3,5-difluorophenyl)methoxymethanol?
The IUPAC name of (4-amino-3,5-difluorophenyl)methoxymethanol (CID 134461789) is (4-amino-3,5-difluorophenyl)methoxymethanol.
What is the SMILES notation for (4-amino-3,5-difluorophenyl)methoxymethanol?
The canonical SMILES for (4-amino-3,5-difluorophenyl)methoxymethanol is Nc1c(F)cc(COCO)cc1F.
What is the InChIKey of (4-amino-3,5-difluorophenyl)methoxymethanol?
The InChIKey is BKEZVAAAYYSUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9F2NO2/c9-6-1-5(3-13-4-12)2-7(10)8(6)11/h1-2,12H,3-4,11H2.
What are the key properties of (4-amino-3,5-difluorophenyl)methoxymethanol?
(4-amino-3,5-difluorophenyl)methoxymethanol has a molecular weight of 189.16 g/mol, XLogP of 1.01, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-3,5-difluorophenyl)methoxymethanol is sourced from PubChem (CID 134461789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).