C38H43F9O6 — CID 134461919
3-O-[(4S)-2-bicyclo[2.2.1]heptanyl] 1-O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 5-O-(1,2,3,4-tetrahydroanthracen-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate (PubChem CID 134461919) has the molecular formula C38H43F9O6 and a molecular weight of 766.74 g/mol. Its IUPAC name is 3-O-[(4S)-2-bicyclo[2.2.1]heptanyl] 1-O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 5-O-(1,2,3,4-tetrahydroanthracen-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-[(4S)-2-bicyclo[2.2.1]heptanyl] 1-O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 5-O-(1,2,3,4-tetrahydroanthracen-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134461919 |
| Molecular Formula | C38H43F9O6 |
| Molecular Weight | 766.74 g/mol |
| Exact Mass | 766.29 |
| IUPAC Name | 3-O-[(4S)-2-bicyclo[2.2.1]heptanyl] 1-O-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl] 5-O-(1,2,3,4-tetrahydroanthracen-2-yl) 1,1,3,5-tetramethylhexane-1,3,5-tricarboxylate |
| SMILES | CC(C)(CC(C)(CC(C)(C)C(=O)OC(C(F)(F)F)(C(F)(F)F)C(F)(F)F)C(=O)OC1C[C@H]2CCC1C2)C(=O)OC1CCc2cc3ccccc3cc2C1 |
| InChI | InChI=1S/C38H43F9O6/c1-32(2,29(48)51-27-13-12-24-16-22-8-6-7-9-23(22)17-26(24)18-27)19-34(5,31(50)52-28-15-21-10-11-25(28)14-21)20-33(3,4)30(49)53-35(36(39,40)41,37(42,43)44)38(45,46)47/h6-9,16-17,21,25,27-28H,10-15,18-20H2,1-5H3/t21-,25?,27?,28?,34?/m0/s1 |
| InChIKey | JMVGFJJIUMJGDE-ZMQFHZBVSA-N |
| XLogP | 9.78 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.74 |
| LogP ≤ 5 | 9.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|