C22H27NO2 — CID 134462128
13-(7-methyloctyl)-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5(15),6,8-pentaen-14-one (PubChem CID 134462128) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 13-(7-methyloctyl)-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5(15),6,8-pentaen-14-one.
| Compound Name | 13-(7-methyloctyl)-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5(15),6,8-pentaen-14-one |
|---|---|
| PubChem CID | 134462128 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 13-(7-methyloctyl)-11-oxa-13-azatetracyclo[7.5.1.05,15.010,12]pentadeca-1,3,5(15),6,8-pentaen-14-one |
| SMILES | CC(C)CCCCCCN1C(=O)c2cccc3cccc(c23)C2OC21 |
| InChI | InChI=1S/C22H27NO2/c1-15(2)9-5-3-4-6-14-23-21(24)18-13-8-11-16-10-7-12-17(19(16)18)20-22(23)25-20/h7-8,10-13,15,20,22H,3-6,9,14H2,1-2H3 |
| InChIKey | ZNBIWBWHLYZJGM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 32.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|