About (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate
(6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate (PubChem CID 134462754) has the molecular formula C13H7BrF2N2O3S
and a molecular weight of 389.18 g/mol. Its IUPAC name is (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate.
Molecular Properties
| Compound Name | (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate |
| PubChem CID | 134462754 |
| Molecular Formula | C13H7BrF2N2O3S |
| Molecular Weight | 389.18 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate |
| SMILES | O=S(=O)(Oc1cc(Br)cn2nccc12)c1ccc(F)cc1F |
| InChI | InChI=1S/C13H7BrF2N2O3S/c14-8-5-12(11-3-4-17-18(11)7-8)21-22(19,20)13-2-1-9(15)6-10(13)16/h1-7H |
| InChIKey | VRPLHNHQHXEYFD-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 60.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.18 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate?
The IUPAC name of (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate (CID 134462754) is (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate.
What is the SMILES notation for (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate?
The canonical SMILES for (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate is O=S(=O)(Oc1cc(Br)cn2nccc12)c1ccc(F)cc1F.
What is the InChIKey of (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate?
The InChIKey is VRPLHNHQHXEYFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrF2N2O3S/c14-8-5-12(11-3-4-17-18(11)7-8)21-22(19,20)13-2-1-9(15)6-10(13)16/h1-7H.
What are the key properties of (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate?
(6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate has a molecular weight of 389.18 g/mol, XLogP of 3.14, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6-bromopyrazolo[1,5-a]pyridin-4-yl) 2,4-difluorobenzenesulfonate is sourced from PubChem (CID 134462754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).