C15H27NO — CID 134462959
(2S,6Z,8Z)-2-(dimethylamino)-5-propan-2-ylidenedeca-6,8-dien-1-ol (PubChem CID 134462959) has the molecular formula C15H27NO and a molecular weight of 237.39 g/mol. Its IUPAC name is (2S,6Z,8Z)-2-(dimethylamino)-5-propan-2-ylidenedeca-6,8-dien-1-ol.
| Compound Name | (2S,6Z,8Z)-2-(dimethylamino)-5-propan-2-ylidenedeca-6,8-dien-1-ol |
|---|---|
| PubChem CID | 134462959 |
| Molecular Formula | C15H27NO |
| Molecular Weight | 237.39 g/mol |
| Exact Mass | 237.21 |
| IUPAC Name | (2S,6Z,8Z)-2-(dimethylamino)-5-propan-2-ylidenedeca-6,8-dien-1-ol |
| SMILES | C/C=C\C=C/C(CC[C@@H](CO)N(C)C)=C(C)C |
| InChI | InChI=1S/C15H27NO/c1-6-7-8-9-14(13(2)3)10-11-15(12-17)16(4)5/h6-9,15,17H,10-12H2,1-5H3/b7-6-,9-8-/t15-/m0/s1 |
| InChIKey | GOQLHWKPRGVRRU-FQGDYJCMSA-N |
| XLogP | 3.16 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|