C7H10N2O — CID 134463158
2,3,5,6-tetrahydro-1H-pyrido[3,4-b][1,4]oxazine (PubChem CID 134463158) has the molecular formula C7H10N2O and a molecular weight of 138.17 g/mol. Its IUPAC name is 2,3,5,6-tetrahydro-1H-pyrido[3,4-b][1,4]oxazine.
| Compound Name | 2,3,5,6-tetrahydro-1H-pyrido[3,4-b][1,4]oxazine |
|---|---|
| PubChem CID | 134463158 |
| Molecular Formula | C7H10N2O |
| Molecular Weight | 138.17 g/mol |
| Exact Mass | 138.08 |
| IUPAC Name | 2,3,5,6-tetrahydro-1H-pyrido[3,4-b][1,4]oxazine |
| SMILES | C1=CC2=C(CN1)OCCN2 |
| InChI | InChI=1S/C7H10N2O/c1-2-8-5-7-6(1)9-3-4-10-7/h1-2,8-9H,3-5H2 |
| InChIKey | NJMMKFHZDKVHRU-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.17 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |