About [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate
[1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 134463173) has the molecular formula C14H20F3NO4
and a molecular weight of 323.31 g/mol. Its IUPAC name is [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
Molecular Properties
| Compound Name | [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| PubChem CID | 134463173 |
| Molecular Formula | C14H20F3NO4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C(=O)NC(=O)C(C)(C)C)C(C)C)C(F)(F)F |
| InChI | InChI=1S/C14H20F3NO4/c1-7(2)9(10(19)18-12(21)13(4,5)6)22-11(20)8(3)14(15,16)17/h7,9H,3H2,1-2,4-6H3,(H,18,19,21) |
| InChIKey | IGNICLCKRWTJBN-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The IUPAC name of [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate (CID 134463173) is [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
What is the SMILES notation for [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The canonical SMILES for [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate is C=C(C(=O)OC(C(=O)NC(=O)C(C)(C)C)C(C)C)C(F)(F)F.
What is the InChIKey of [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
The InChIKey is IGNICLCKRWTJBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20F3NO4/c1-7(2)9(10(19)18-12(21)13(4,5)6)22-11(20)8(3)14(15,16)17/h7,9H,3H2,1-2,4-6H3,(H,18,19,21).
What are the key properties of [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate?
[1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate has a molecular weight of 323.31 g/mol, XLogP of 2.36, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,2-dimethylpropanoylamino)-3-methyl-1-oxobutan-2-yl] 2-(trifluoromethyl)prop-2-enoate is sourced from PubChem (CID 134463173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).