C42H65F4NO9 — CID 134463350
3-O-[1-[(4-methylbenzoyl)-propan-2-ylamino]-1-oxopropan-2-yl] 5-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 1-O-(2,3,3-trimethylbutan-2-yl) 1-fluoro-1,3-dimethylheptane-1,3,5-tricarboxylate (PubChem CID 134463350) has the molecular formula C42H65F4NO9 and a molecular weight of 803.97 g/mol. Its IUPAC name is 3-O-[1-[(4-methylbenzoyl)-propan-2-ylamino]-1-oxopropan-2-yl] 5-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 1-O-(2,3,3-trimethylbutan-2-yl) 1-fluoro-1,3-dimethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-[1-[(4-methylbenzoyl)-propan-2-ylamino]-1-oxopropan-2-yl] 5-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 1-O-(2,3,3-trimethylbutan-2-yl) 1-fluoro-1,3-dimethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 134463350 |
| Molecular Formula | C42H65F4NO9 |
| Molecular Weight | 803.97 g/mol |
| Exact Mass | 803.46 |
| IUPAC Name | 3-O-[1-[(4-methylbenzoyl)-propan-2-ylamino]-1-oxopropan-2-yl] 5-O-(1,1,1-trifluoro-2-hydroxy-2,6-dimethylheptan-4-yl) 1-O-(2,3,3-trimethylbutan-2-yl) 1-fluoro-1,3-dimethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(CC(C)(CC(C)(F)C(=O)OC(C)(C)C(C)(C)C)C(=O)OC(C)C(=O)N(C(=O)c1ccc(C)cc1)C(C)C)C(=O)OC(CC(C)C)CC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C42H65F4NO9/c1-16-29(34(50)55-31(21-25(2)3)23-41(15,53)42(44,45)46)22-39(13,24-40(14,43)36(52)56-38(11,12)37(8,9)10)35(51)54-28(7)32(48)47(26(4)5)33(49)30-19-17-27(6)18-20-30/h17-20,25-26,28-29,31,53H,16,21-24H2,1-15H3 |
| InChIKey | CXWFPKDSELRCQK-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.97 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|