C39H62F3NO7 — CID 134463360
1-O-(1,1,1-trifluoro-2-hydroxy-2-methylheptan-4-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-2,4,6-trimethyl-4-[(4-methylbenzoyl)-propan-2-ylcarbamoyl]heptanedioate (PubChem CID 134463360) has the molecular formula C39H62F3NO7 and a molecular weight of 713.92 g/mol. Its IUPAC name is 1-O-(1,1,1-trifluoro-2-hydroxy-2-methylheptan-4-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-2,4,6-trimethyl-4-[(4-methylbenzoyl)-propan-2-ylcarbamoyl]heptanedioate.
| Compound Name | 1-O-(1,1,1-trifluoro-2-hydroxy-2-methylheptan-4-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-2,4,6-trimethyl-4-[(4-methylbenzoyl)-propan-2-ylcarbamoyl]heptanedioate |
|---|---|
| PubChem CID | 134463360 |
| Molecular Formula | C39H62F3NO7 |
| Molecular Weight | 713.92 g/mol |
| Exact Mass | 713.45 |
| IUPAC Name | 1-O-(1,1,1-trifluoro-2-hydroxy-2-methylheptan-4-yl) 7-O-(2,3,3-trimethylbutan-2-yl) 2-ethyl-2,4,6-trimethyl-4-[(4-methylbenzoyl)-propan-2-ylcarbamoyl]heptanedioate |
| SMILES | CCCC(CC(C)(O)C(F)(F)F)OC(=O)C(C)(CC)CC(C)(CC(C)C(=O)OC(C)(C)C(C)(C)C)C(=O)N(C(=O)c1ccc(C)cc1)C(C)C |
| InChI | InChI=1S/C39H62F3NO7/c1-15-17-29(23-38(14,48)39(40,41)42)49-33(47)36(12,16-2)24-37(13,22-27(6)31(45)50-35(10,11)34(7,8)9)32(46)43(25(3)4)30(44)28-20-18-26(5)19-21-28/h18-21,25,27,29,48H,15-17,22-24H2,1-14H3 |
| InChIKey | FHEKXYCIUCUJEG-UHFFFAOYSA-N |
| XLogP | 8.99 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.92 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |