About N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide
N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide (PubChem CID 134463859) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide.
Molecular Properties
| Compound Name | N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide |
| PubChem CID | 134463859 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide |
| SMILES | [H]/N=C/CCCCC(/C=N/C=N/C)=C\C |
| InChI | InChI=1S/C11H19N3/c1-3-11(9-14-10-13-2)7-5-4-6-8-12/h3,8-10,12H,4-7H2,1-2H3/b11-3+,12-8+,13-10+,14-9+ |
| InChIKey | LCHVSSDUVMKTPN-AMJJFGKISA-N |
| XLogP | 2.87 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide?
The IUPAC name of N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide (CID 134463859) is N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide.
What is the SMILES notation for N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide?
The canonical SMILES for N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide is [H]/N=C/CCCCC(/C=N/C=N/C)=C\C.
What is the InChIKey of N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide?
The InChIKey is LCHVSSDUVMKTPN-AMJJFGKISA-N. The full InChI is InChI=1S/C11H19N3/c1-3-11(9-14-10-13-2)7-5-4-6-8-12/h3,8-10,12H,4-7H2,1-2H3/b11-3+,12-8+,13-10+,14-9+.
What are the key properties of N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide?
N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide has a molecular weight of 193.29 g/mol, XLogP of 2.87, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-2-ethylidene-7-iminoheptylidene]-N'-methylmethanimidamide is sourced from PubChem (CID 134463859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).