About N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine
N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine (PubChem CID 134464155) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine.
Molecular Properties
| Compound Name | N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine |
| PubChem CID | 134464155 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine |
| SMILES | C=NC(/C=C/C)=C(\C)CCCC |
| InChI | InChI=1S/C11H19N/c1-5-7-9-10(3)11(12-4)8-6-2/h6,8H,4-5,7,9H2,1-3H3/b8-6+,11-10+ |
| InChIKey | ITGRIKMYFJERNP-UMYLGFLZSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine?
The IUPAC name of N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine (CID 134464155) is N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine.
What is the SMILES notation for N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine?
The canonical SMILES for N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine is C=NC(/C=C/C)=C(\C)CCCC.
What is the InChIKey of N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine?
The InChIKey is ITGRIKMYFJERNP-UMYLGFLZSA-N. The full InChI is InChI=1S/C11H19N/c1-5-7-9-10(3)11(12-4)8-6-2/h6,8H,4-5,7,9H2,1-3H3/b8-6+,11-10+.
What are the key properties of N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine?
N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine has a molecular weight of 165.28 g/mol, XLogP of 3.73, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E,4E)-5-methylnona-2,4-dien-4-yl]methanimine is sourced from PubChem (CID 134464155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).