C16H38Si4 — CID 13446426
trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,3-dienyl]silane (PubChem CID 13446426) has the molecular formula C16H38Si4 and a molecular weight of 342.82 g/mol. Its IUPAC name is trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,3-dienyl]silane.
| Compound Name | trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,3-dienyl]silane |
|---|---|
| PubChem CID | 13446426 |
| Molecular Formula | C16H38Si4 |
| Molecular Weight | 342.82 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,3-dienyl]silane |
| SMILES | C[Si](C)(C)C(=CC=C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H38Si4/c1-17(2,3)15(18(4,5)6)13-14-16(19(7,8)9)20(10,11)12/h13-14H,1-12H3 |
| InChIKey | YFKDMNRWBLXPTC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.82 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|