C31H24F2N6O4S — CID 134464764
(3R)-11-[(4-azidophenyl)methoxy]-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione (PubChem CID 134464764) has the molecular formula C31H24F2N6O4S and a molecular weight of 614.63 g/mol. Its IUPAC name is (3R)-11-[(4-azidophenyl)methoxy]-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3R)-11-[(4-azidophenyl)methoxy]-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 134464764 |
| Molecular Formula | C31H24F2N6O4S |
| Molecular Weight | 614.63 g/mol |
| Exact Mass | 614.15 |
| IUPAC Name | (3R)-11-[(4-azidophenyl)methoxy]-2-[(11S)-7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepin-11-yl]-5-oxa-1,2,8-triazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-9,12-dione |
| SMILES | [N-]=[N+]=Nc1ccc(COc2c3n(ccc2=O)N([C@@H]2c4ccccc4SCc4c2ccc(F)c4F)[C@@H]2COCCN2C3=O)cc1 |
| InChI | InChI=1S/C31H24F2N6O4S/c32-23-10-9-20-22(27(23)33)17-44-25-4-2-1-3-21(25)28(20)39-26-16-42-14-13-37(26)31(41)29-30(24(40)11-12-38(29)39)43-15-18-5-7-19(8-6-18)35-36-34/h1-12,26,28H,13-17H2/t26-,28+/m1/s1 |
| InChIKey | TWIRNKPPFCNTPM-IAPPQJPRSA-N |
| XLogP | 5.79 |
| TPSA | 112.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.63 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|