C15H31N3O — CID 13446522
N-[4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide (PubChem CID 13446522) has the molecular formula C15H31N3O and a molecular weight of 269.43 g/mol. Its IUPAC name is N-[4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide.
| Compound Name | N-[4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide |
|---|---|
| PubChem CID | 13446522 |
| Molecular Formula | C15H31N3O |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.25 |
| IUPAC Name | N-[4-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]butyl]acetamide |
| SMILES | CC(=O)NCCCCNC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C15H31N3O/c1-12(19)16-8-6-7-9-17-13-10-14(2,3)18-15(4,5)11-13/h13,17-18H,6-11H2,1-5H3,(H,16,19) |
| InChIKey | VFCHJTNJAADHRN-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|