C20H39N3O2 — CID 13446526
N-[7-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptyl]acetamide (PubChem CID 13446526) has the molecular formula C20H39N3O2 and a molecular weight of 353.55 g/mol. Its IUPAC name is N-[7-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptyl]acetamide.
| Compound Name | N-[7-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptyl]acetamide |
|---|---|
| PubChem CID | 13446526 |
| Molecular Formula | C20H39N3O2 |
| Molecular Weight | 353.55 g/mol |
| Exact Mass | 353.30 |
| IUPAC Name | N-[7-[acetyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]heptyl]acetamide |
| SMILES | CC(=O)NCCCCCCCN(C(C)=O)C1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C20H39N3O2/c1-16(24)21-12-10-8-7-9-11-13-23(17(2)25)18-14-19(3,4)22-20(5,6)15-18/h18,22H,7-15H2,1-6H3,(H,21,24) |
| InChIKey | ROVIMHWXTFQHDA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.55 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|