C27H29N3O5S3 — CID 134465291
2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 4-oxopentanoate (PubChem CID 134465291) has the molecular formula C27H29N3O5S3 and a molecular weight of 571.75 g/mol. Its IUPAC name is 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 4-oxopentanoate.
| Compound Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 134465291 |
| Molecular Formula | C27H29N3O5S3 |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.13 |
| IUPAC Name | 2-[4-[3-amino-2-butylsulfinyl-6-(1,3-thiazol-2-yl)thieno[2,3-b]pyridin-4-yl]phenoxy]ethyl 4-oxopentanoate |
| SMILES | CCCCS(=O)c1sc2nc(-c3nccs3)cc(-c3ccc(OCCOC(=O)CCC(C)=O)cc3)c2c1N |
| InChI | InChI=1S/C27H29N3O5S3/c1-3-4-15-38(33)27-24(28)23-20(16-21(30-26(23)37-27)25-29-11-14-36-25)18-6-8-19(9-7-18)34-12-13-35-22(32)10-5-17(2)31/h6-9,11,14,16H,3-5,10,12-13,15,28H2,1-2H3 |
| InChIKey | VEXYRLPVQJGKSM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 121.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|