C28H27F6N3O3 — CID 134465372
2-[1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid (PubChem CID 134465372) has the molecular formula C28H27F6N3O3 and a molecular weight of 567.53 g/mol. Its IUPAC name is 2-[1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid.
| Compound Name | 2-[1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 134465372 |
| Molecular Formula | C28H27F6N3O3 |
| Molecular Weight | 567.53 g/mol |
| Exact Mass | 567.20 |
| IUPAC Name | 2-[1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetic acid |
| SMILES | O=C(O)CC1CN(Cc2ccncc2)CCN1Cc1ccc(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C28H27F6N3O3/c29-27(30,31)26(40,28(32,33)34)23-7-5-22(6-8-23)21-3-1-19(2-4-21)17-37-14-13-36(18-24(37)15-25(38)39)16-20-9-11-35-12-10-20/h1-12,24,40H,13-18H2,(H,38,39) |
| InChIKey | CQDGRVYZANDOQR-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.53 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |