C31H34F6N4O3 — CID 134465381
2-aminoethyl 2-[(2S)-1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465381) has the molecular formula C31H34F6N4O3 and a molecular weight of 624.63 g/mol. Its IUPAC name is 2-aminoethyl 2-[(2S)-1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | 2-aminoethyl 2-[(2S)-1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465381 |
| Molecular Formula | C31H34F6N4O3 |
| Molecular Weight | 624.63 g/mol |
| Exact Mass | 624.25 |
| IUPAC Name | 2-aminoethyl 2-[(2S)-1-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-4-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | Cc1cc(CN2CCN(Cc3ccncc3)C[C@@H]2CC(=O)OCCN)ccc1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C31H34F6N4O3/c1-21-16-23(2-7-27(21)24-3-5-25(6-4-24)29(43,30(32,33)34)31(35,36)37)19-41-14-13-40(18-22-8-11-39-12-9-22)20-26(41)17-28(42)44-15-10-38/h2-9,11-12,16,26,43H,10,13-15,17-20,38H2,1H3/t26-/m0/s1 |
| InChIKey | YBSNVKXXPRFHLT-SANMLTNESA-N |
| XLogP | 4.95 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.63 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |