C30H31F6N3O3 — CID 134465422
ethyl 2-[(2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465422) has the molecular formula C30H31F6N3O3 and a molecular weight of 595.58 g/mol. Its IUPAC name is ethyl 2-[(2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[(2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465422 |
| Molecular Formula | C30H31F6N3O3 |
| Molecular Weight | 595.58 g/mol |
| Exact Mass | 595.23 |
| IUPAC Name | ethyl 2-[(2R)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | CCOC(=O)C[C@@H]1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C30H31F6N3O3/c1-2-42-27(40)17-26-20-38(15-16-39(26)19-22-11-13-37-14-12-22)18-21-3-5-23(6-4-21)24-7-9-25(10-8-24)28(41,29(31,32)33)30(34,35)36/h3-14,26,41H,2,15-20H2,1H3/t26-/m1/s1 |
| InChIKey | QVZOYLZUQKUYSY-AREMUKBSSA-N |
| XLogP | 5.70 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |