C30H32F6N4O2 — CID 134465429
4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-N-propan-2-yl-1-(pyridin-4-ylmethyl)piperazine-2-carboxamide (PubChem CID 134465429) has the molecular formula C30H32F6N4O2 and a molecular weight of 594.60 g/mol. Its IUPAC name is 4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-N-propan-2-yl-1-(pyridin-4-ylmethyl)piperazine-2-carboxamide.
| Compound Name | 4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-N-propan-2-yl-1-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
|---|---|
| PubChem CID | 134465429 |
| Molecular Formula | C30H32F6N4O2 |
| Molecular Weight | 594.60 g/mol |
| Exact Mass | 594.24 |
| IUPAC Name | 4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-N-propan-2-yl-1-(pyridin-4-ylmethyl)piperazine-2-carboxamide |
| SMILES | CC(C)NC(=O)C1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C30H32F6N4O2/c1-20(2)38-27(41)26-19-39(15-16-40(26)18-22-11-13-37-14-12-22)17-21-3-5-23(6-4-21)24-7-9-25(10-8-24)28(42,29(31,32)33)30(34,35)36/h3-14,20,26,42H,15-19H2,1-2H3,(H,38,41) |
| InChIKey | LXPZAZYKVAJWIH-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.60 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |