C31H33F6N3O3 — CID 134465472
ethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465472) has the molecular formula C31H33F6N3O3 and a molecular weight of 609.61 g/mol. Its IUPAC name is ethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | ethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465472 |
| Molecular Formula | C31H33F6N3O3 |
| Molecular Weight | 609.61 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | ethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-3-methylphenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | CCOC(=O)CC1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)c(C)c2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C31H33F6N3O3/c1-3-43-28(41)17-26-20-39(14-15-40(26)19-22-10-12-38-13-11-22)18-23-4-9-27(21(2)16-23)24-5-7-25(8-6-24)29(42,30(32,33)34)31(35,36)37/h4-13,16,26,42H,3,14-15,17-20H2,1-2H3 |
| InChIKey | FOAQMZKLEYGWDE-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 65.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.61 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |