C30H32F6N4O3 — CID 134465475
2-aminoethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465475) has the molecular formula C30H32F6N4O3 and a molecular weight of 610.60 g/mol. Its IUPAC name is 2-aminoethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | 2-aminoethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465475 |
| Molecular Formula | C30H32F6N4O3 |
| Molecular Weight | 610.60 g/mol |
| Exact Mass | 610.24 |
| IUPAC Name | 2-aminoethyl 2-[4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | NCCOC(=O)CC1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C30H32F6N4O3/c31-29(32,33)28(42,30(34,35)36)25-7-5-24(6-8-25)23-3-1-21(2-4-23)18-39-14-15-40(19-22-9-12-38-13-10-22)26(20-39)17-27(41)43-16-11-37/h1-10,12-13,26,42H,11,14-20,37H2 |
| InChIKey | TYMGTFSYYVCCGN-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.60 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |