C32H35F6N3O4 — CID 134465490
2-ethoxyethyl 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate (PubChem CID 134465490) has the molecular formula C32H35F6N3O4 and a molecular weight of 639.64 g/mol. Its IUPAC name is 2-ethoxyethyl 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate.
| Compound Name | 2-ethoxyethyl 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
|---|---|
| PubChem CID | 134465490 |
| Molecular Formula | C32H35F6N3O4 |
| Molecular Weight | 639.64 g/mol |
| Exact Mass | 639.25 |
| IUPAC Name | 2-ethoxyethyl 2-[(2S)-4-[[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]phenyl]methyl]-1-(pyridin-4-ylmethyl)piperazin-2-yl]acetate |
| SMILES | CCOCCOC(=O)C[C@H]1CN(Cc2ccc(-c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)cc2)CCN1Cc1ccncc1 |
| InChI | InChI=1S/C32H35F6N3O4/c1-2-44-17-18-45-29(42)19-28-22-40(15-16-41(28)21-24-11-13-39-14-12-24)20-23-3-5-25(6-4-23)26-7-9-27(10-8-26)30(43,31(33,34)35)32(36,37)38/h3-14,28,43H,2,15-22H2,1H3/t28-/m0/s1 |
| InChIKey | CAZOGATWSXIPNB-NDEPHWFRSA-N |
| XLogP | 5.72 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.64 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|