About [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate
[2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate (PubChem CID 134465600) has the molecular formula C16H18ClF2NO3S
and a molecular weight of 377.84 g/mol. Its IUPAC name is [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate.
Molecular Properties
| Compound Name | [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate |
| PubChem CID | 134465600 |
| Molecular Formula | C16H18ClF2NO3S |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate |
| SMILES | CS(=O)OC1CCC2(CC1)CCN(c1cc(F)c(F)cc1Cl)C2=O |
| InChI | InChI=1S/C16H18ClF2NO3S/c1-24(22)23-10-2-4-16(5-3-10)6-7-20(15(16)21)14-9-13(19)12(18)8-11(14)17/h8-10H,2-7H2,1H3 |
| InChIKey | GDFNREQGXJYTNL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate?
The IUPAC name of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate (CID 134465600) is [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate.
What is the SMILES notation for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate?
The canonical SMILES for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate is CS(=O)OC1CCC2(CC1)CCN(c1cc(F)c(F)cc1Cl)C2=O.
What is the InChIKey of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate?
The InChIKey is GDFNREQGXJYTNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClF2NO3S/c1-24(22)23-10-2-4-16(5-3-10)6-7-20(15(16)21)14-9-13(19)12(18)8-11(14)17/h8-10H,2-7H2,1H3.
What are the key properties of [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate?
[2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate has a molecular weight of 377.84 g/mol, XLogP of 3.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-chloro-4,5-difluorophenyl)-1-oxo-2-azaspiro[4.5]decan-8-yl] methanesulfinate is sourced from PubChem (CID 134465600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).