C25H31FO3 — CID 134465797
methyl 3-[3-[2-[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]ethyl]phenyl]propanoate (PubChem CID 134465797) has the molecular formula C25H31FO3 and a molecular weight of 398.52 g/mol. Its IUPAC name is methyl 3-[3-[2-[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]ethyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[2-[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 134465797 |
| Molecular Formula | C25H31FO3 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | methyl 3-[3-[2-[4-(2-fluoro-5-methoxyphenyl)cyclohexyl]ethyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1cccc(CCC2CCC(c3cc(OC)ccc3F)CC2)c1 |
| InChI | InChI=1S/C25H31FO3/c1-28-22-13-14-24(26)23(17-22)21-11-8-18(9-12-21)6-7-19-4-3-5-20(16-19)10-15-25(27)29-2/h3-5,13-14,16-18,21H,6-12,15H2,1-2H3 |
| InChIKey | CUQDVRMDDBRULS-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |