C16H31N3 — CID 134466051
(Z)-3-ethanimidoyl-1-N-(2,4,4-trimethylcyclohexyl)pent-3-ene-1,4-diamine (PubChem CID 134466051) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is (Z)-3-ethanimidoyl-1-N-(2,4,4-trimethylcyclohexyl)pent-3-ene-1,4-diamine.
| Compound Name | (Z)-3-ethanimidoyl-1-N-(2,4,4-trimethylcyclohexyl)pent-3-ene-1,4-diamine |
|---|---|
| PubChem CID | 134466051 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | (Z)-3-ethanimidoyl-1-N-(2,4,4-trimethylcyclohexyl)pent-3-ene-1,4-diamine |
| SMILES | [H]/N=C(C)/C(CCNC1CCC(C)(C)CC1C)=C(/C)N |
| InChI | InChI=1S/C16H31N3/c1-11-10-16(4,5)8-6-15(11)19-9-7-14(12(2)17)13(3)18/h11,15,17,19H,6-10,18H2,1-5H3/b14-13-,17-12+ |
| InChIKey | IXLCLZDGHXWZAS-AHKZZRKOSA-N |
| XLogP | 3.45 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|