About (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine
(3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (PubChem CID 134466153) has the molecular formula C15H23ClFN
and a molecular weight of 271.81 g/mol. Its IUPAC name is (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
Molecular Properties
| Compound Name | (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| PubChem CID | 134466153 |
| Molecular Formula | C15H23ClFN |
| Molecular Weight | 271.81 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine |
| SMILES | C=C/C(Cl)=C(\C=C/C)CCNCC1(F)CCCC1 |
| InChI | InChI=1S/C15H23ClFN/c1-3-7-13(14(16)4-2)8-11-18-12-15(17)9-5-6-10-15/h3-4,7,18H,2,5-6,8-12H2,1H3/b7-3-,14-13- |
| InChIKey | WPJLTUIKAYLAAR-AFEMCNPNSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The IUPAC name of (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine (CID 134466153) is (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine.
What is the SMILES notation for (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The canonical SMILES for (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine is C=C/C(Cl)=C(\C=C/C)CCNCC1(F)CCCC1.
What is the InChIKey of (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
The InChIKey is WPJLTUIKAYLAAR-AFEMCNPNSA-N. The full InChI is InChI=1S/C15H23ClFN/c1-3-7-13(14(16)4-2)8-11-18-12-15(17)9-5-6-10-15/h3-4,7,18H,2,5-6,8-12H2,1H3/b7-3-,14-13-.
What are the key properties of (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine?
(3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine has a molecular weight of 271.81 g/mol, XLogP of 4.50, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-chloro-N-[(1-fluorocyclopentyl)methyl]-3-[(Z)-prop-1-enyl]hexa-3,5-dien-1-amine is sourced from PubChem (CID 134466153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).