C16H27NO2 — CID 13446617
ethyl 5-(diethylamino)-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate (PubChem CID 13446617) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is ethyl 5-(diethylamino)-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate.
| Compound Name | ethyl 5-(diethylamino)-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
|---|---|
| PubChem CID | 13446617 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | ethyl 5-(diethylamino)-2,3,3a,4,5,7a-hexahydro-1H-indene-4-carboxylate |
| SMILES | CCOC(=O)C1C2CCCC2C=CC1N(CC)CC |
| InChI | InChI=1S/C16H27NO2/c1-4-17(5-2)14-11-10-12-8-7-9-13(12)15(14)16(18)19-6-3/h10-15H,4-9H2,1-3H3 |
| InChIKey | SJEUIMLKMYSYDR-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|